This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Indicateur
| Marque | Thermo Scientific Acros |
|---|---|
| Réf. B-LABO | BL-RE-159435 |
| Réf. fabricant | 11956831 |
| Nom chimique ou matériau | Bromophenol Blue |
| CAS | 115-39-9, 7732-18-5 |
| Concentration | about 0.1% (by UV) |
| Formule moléculaire | C19H10Br4O5S |
| Synonyme | 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' |
| Clé InChI | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Nom IUPAC | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphényl)-1,1-dioxo-2,1,lambda{6}-benzoxathiol-3-yl]phénol |
| Poids moléculaire (g/mol) | 669.96 |
| CID PubChem | 8272 |
| ChEBI | CHEBI:59424 |
| Poids de la formule | 669.96 |
| Qualité | Pures |
| Conditionnement | Flacon en verre |
| Gravité spécifique | 1 |
| Densité | 1.0000g/mL |
| Quantité | 100 mL |
